C24H28N4OS — CID 18285209
N-[1-[[3-(2,5-dimethylphenyl)-2-sulfanylideneimidazol-1-yl]methyl]piperidin-4-yl]benzamide (PubChem CID 18285209) has the molecular formula C24H28N4OS and a molecular weight of 420.58 g/mol. Its IUPAC name is N-[1-[[3-(2,5-dimethylphenyl)-2-sulfanylideneimidazol-1-yl]methyl]piperidin-4-yl]benzamide.
| Compound Name | N-[1-[[3-(2,5-dimethylphenyl)-2-sulfanylideneimidazol-1-yl]methyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 18285209 |
| Molecular Formula | C24H28N4OS |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | N-[1-[[3-(2,5-dimethylphenyl)-2-sulfanylideneimidazol-1-yl]methyl]piperidin-4-yl]benzamide |
| SMILES | Cc1ccc(C)c(-n2ccn(CN3CCC(NC(=O)c4ccccc4)CC3)c2=S)c1 |
| InChI | InChI=1S/C24H28N4OS/c1-18-8-9-19(2)22(16-18)28-15-14-27(24(28)30)17-26-12-10-21(11-13-26)25-23(29)20-6-4-3-5-7-20/h3-9,14-16,21H,10-13,17H2,1-2H3,(H,25,29) |
| InChIKey | YFBLXOVJZCESTO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 42.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|