C23H29N5OS — CID 55860724
4-(2,4-dimethylphenyl)-2-[[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methyl]-1,2,4-triazole-3-thione (PubChem CID 55860724) has the molecular formula C23H29N5OS and a molecular weight of 423.59 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)-2-[[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methyl]-1,2,4-triazole-3-thione.
| Compound Name | 4-(2,4-dimethylphenyl)-2-[[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 55860724 |
| Molecular Formula | C23H29N5OS |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 4-(2,4-dimethylphenyl)-2-[[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methyl]-1,2,4-triazole-3-thione |
| SMILES | COc1ccc(N2CCCN(Cn3ncn(-c4ccc(C)cc4C)c3=S)CC2)cc1 |
| InChI | InChI=1S/C23H29N5OS/c1-18-5-10-22(19(2)15-18)27-16-24-28(23(27)30)17-25-11-4-12-26(14-13-25)20-6-8-21(29-3)9-7-20/h5-10,15-16H,4,11-14,17H2,1-3H3 |
| InChIKey | XVNYPBSDLOYYQX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 38.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|