C21H31N5OS2 — CID 78904498
5-(cyclohexylamino)-3-[[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methyl]-1,3,4-thiadiazole-2-thione (PubChem CID 78904498) has the molecular formula C21H31N5OS2 and a molecular weight of 433.65 g/mol. Its IUPAC name is 5-(cyclohexylamino)-3-[[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methyl]-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-(cyclohexylamino)-3-[[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methyl]-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 78904498 |
| Molecular Formula | C21H31N5OS2 |
| Molecular Weight | 433.65 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 5-(cyclohexylamino)-3-[[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methyl]-1,3,4-thiadiazole-2-thione |
| SMILES | COc1ccc(N2CCCN(Cn3nc(NC4CCCCC4)sc3=S)CC2)cc1 |
| InChI | InChI=1S/C21H31N5OS2/c1-27-19-10-8-18(9-11-19)25-13-5-12-24(14-15-25)16-26-21(28)29-20(23-26)22-17-6-3-2-4-7-17/h8-11,17H,2-7,12-16H2,1H3,(H,22,23) |
| InChIKey | PGPCUMJOUGTKNG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 45.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.65 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|