C20H21N5OS2 — CID 2428145
2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-[1,2,4]triazolo[3,4-b][1,3]benzothiazole-1-thione (PubChem CID 2428145) has the molecular formula C20H21N5OS2 and a molecular weight of 411.56 g/mol. Its IUPAC name is 2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-[1,2,4]triazolo[3,4-b][1,3]benzothiazole-1-thione.
| Compound Name | 2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-[1,2,4]triazolo[3,4-b][1,3]benzothiazole-1-thione |
|---|---|
| PubChem CID | 2428145 |
| Molecular Formula | C20H21N5OS2 |
| Molecular Weight | 411.56 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-[1,2,4]triazolo[3,4-b][1,3]benzothiazole-1-thione |
| SMILES | COc1ccc(N2CCN(Cn3nc4sc5ccccc5n4c3=S)CC2)cc1 |
| InChI | InChI=1S/C20H21N5OS2/c1-26-16-8-6-15(7-9-16)23-12-10-22(11-13-23)14-24-20(27)25-17-4-2-3-5-18(17)28-19(25)21-24/h2-9H,10-14H2,1H3 |
| InChIKey | UKDQJLCEAQFKFP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 37.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.56 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|