C15H18N6O — CID 86776623
1-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,2,4-triazole-3-carbonitrile (PubChem CID 86776623) has the molecular formula C15H18N6O and a molecular weight of 298.35 g/mol. Its IUPAC name is 1-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,2,4-triazole-3-carbonitrile.
| Compound Name | 1-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,2,4-triazole-3-carbonitrile |
|---|---|
| PubChem CID | 86776623 |
| Molecular Formula | C15H18N6O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 1-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,2,4-triazole-3-carbonitrile |
| SMILES | COc1ccc(N2CCN(Cn3cnc(C#N)n3)CC2)cc1 |
| InChI | InChI=1S/C15H18N6O/c1-22-14-4-2-13(3-5-14)20-8-6-19(7-9-20)12-21-11-17-15(10-16)18-21/h2-5,11H,6-9,12H2,1H3 |
| InChIKey | HBXBBCLWDUZSBO-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 70.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|