C18H21N5O2 — CID 17422926
2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 17422926) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is 2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 17422926 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | COc1ccc(N2CCN(Cn3nc4ccccn4c3=O)CC2)cc1 |
| InChI | InChI=1S/C18H21N5O2/c1-25-16-7-5-15(6-8-16)21-12-10-20(11-13-21)14-23-18(24)22-9-3-2-4-17(22)19-23/h2-9H,10-14H2,1H3 |
| InChIKey | LWCDEYMDDDLSDZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 55.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|