C14H18FN5S — CID 2393421
2-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-4-methyl-1,2,4-triazole-3-thione (PubChem CID 2393421) has the molecular formula C14H18FN5S and a molecular weight of 307.40 g/mol. Its IUPAC name is 2-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-4-methyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-4-methyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 2393421 |
| Molecular Formula | C14H18FN5S |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 2-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-4-methyl-1,2,4-triazole-3-thione |
| SMILES | Cn1cnn(CN2CCN(c3ccc(F)cc3)CC2)c1=S |
| InChI | InChI=1S/C14H18FN5S/c1-17-10-16-20(14(17)21)11-18-6-8-19(9-7-18)13-4-2-12(15)3-5-13/h2-5,10H,6-9,11H2,1H3 |
| InChIKey | FEHCDLCVFMSPJA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 29.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|