C18H18FN5OS — CID 71577680
3-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5-pyridin-4-yl-1,3,4-oxadiazole-2-thione (PubChem CID 71577680) has the molecular formula C18H18FN5OS and a molecular weight of 371.44 g/mol. Its IUPAC name is 3-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5-pyridin-4-yl-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5-pyridin-4-yl-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 71577680 |
| Molecular Formula | C18H18FN5OS |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 3-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5-pyridin-4-yl-1,3,4-oxadiazole-2-thione |
| SMILES | Fc1ccc(N2CCN(Cn3nc(-c4ccncc4)oc3=S)CC2)cc1 |
| InChI | InChI=1S/C18H18FN5OS/c19-15-1-3-16(4-2-15)23-11-9-22(10-12-23)13-24-18(26)25-17(21-24)14-5-7-20-8-6-14/h1-8H,9-13H2 |
| InChIKey | XHKVBBGBGXFRPK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 50.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|