C20H22FN5O2S — CID 9330629
3-[[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]methyl]-5-pyridin-3-yl-1,3,4-oxadiazole-2-thione (PubChem CID 9330629) has the molecular formula C20H22FN5O2S and a molecular weight of 415.49 g/mol. Its IUPAC name is 3-[[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]methyl]-5-pyridin-3-yl-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]methyl]-5-pyridin-3-yl-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 9330629 |
| Molecular Formula | C20H22FN5O2S |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 3-[[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]methyl]-5-pyridin-3-yl-1,3,4-oxadiazole-2-thione |
| SMILES | COc1ccc(F)cc1CN1CCN(Cn2nc(-c3cccnc3)oc2=S)CC1 |
| InChI | InChI=1S/C20H22FN5O2S/c1-27-18-5-4-17(21)11-16(18)13-24-7-9-25(10-8-24)14-26-20(29)28-19(23-26)15-3-2-6-22-12-15/h2-6,11-12H,7-10,13-14H2,1H3 |
| InChIKey | YMOPMLAKBOCWMM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 59.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|