C20H23N5OS — CID 9171111
3-[[4-[(2-methylphenyl)methyl]piperazin-1-yl]methyl]-5-pyridin-3-yl-1,3,4-oxadiazole-2-thione (PubChem CID 9171111) has the molecular formula C20H23N5OS and a molecular weight of 381.51 g/mol. Its IUPAC name is 3-[[4-[(2-methylphenyl)methyl]piperazin-1-yl]methyl]-5-pyridin-3-yl-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[[4-[(2-methylphenyl)methyl]piperazin-1-yl]methyl]-5-pyridin-3-yl-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 9171111 |
| Molecular Formula | C20H23N5OS |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 3-[[4-[(2-methylphenyl)methyl]piperazin-1-yl]methyl]-5-pyridin-3-yl-1,3,4-oxadiazole-2-thione |
| SMILES | Cc1ccccc1CN1CCN(Cn2nc(-c3cccnc3)oc2=S)CC1 |
| InChI | InChI=1S/C20H23N5OS/c1-16-5-2-3-6-18(16)14-23-9-11-24(12-10-23)15-25-20(27)26-19(22-25)17-7-4-8-21-13-17/h2-8,13H,9-12,14-15H2,1H3 |
| InChIKey | FKDNEIYJJSZXGQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 50.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|