C12H14N4OS2 — CID 47296146
5-pyridin-3-yl-3-(thiomorpholin-4-ylmethyl)-1,3,4-oxadiazole-2-thione (PubChem CID 47296146) has the molecular formula C12H14N4OS2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 5-pyridin-3-yl-3-(thiomorpholin-4-ylmethyl)-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-pyridin-3-yl-3-(thiomorpholin-4-ylmethyl)-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 47296146 |
| Molecular Formula | C12H14N4OS2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 5-pyridin-3-yl-3-(thiomorpholin-4-ylmethyl)-1,3,4-oxadiazole-2-thione |
| SMILES | S=c1oc(-c2cccnc2)nn1CN1CCSCC1 |
| InChI | InChI=1S/C12H14N4OS2/c18-12-16(9-15-4-6-19-7-5-15)14-11(17-12)10-2-1-3-13-8-10/h1-3,8H,4-7,9H2 |
| InChIKey | MQBPDGCXAMQYNV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 47.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|