C18H26N4O3S3 — CID 55735305
N,N-diethyl-3-[5-sulfanylidene-4-(1,4-thiazepan-4-ylmethyl)-1,3,4-oxadiazol-2-yl]benzenesulfonamide (PubChem CID 55735305) has the molecular formula C18H26N4O3S3 and a molecular weight of 442.63 g/mol. Its IUPAC name is N,N-diethyl-3-[5-sulfanylidene-4-(1,4-thiazepan-4-ylmethyl)-1,3,4-oxadiazol-2-yl]benzenesulfonamide.
| Compound Name | N,N-diethyl-3-[5-sulfanylidene-4-(1,4-thiazepan-4-ylmethyl)-1,3,4-oxadiazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 55735305 |
| Molecular Formula | C18H26N4O3S3 |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | N,N-diethyl-3-[5-sulfanylidene-4-(1,4-thiazepan-4-ylmethyl)-1,3,4-oxadiazol-2-yl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(-c2nn(CN3CCCSCC3)c(=S)o2)c1 |
| InChI | InChI=1S/C18H26N4O3S3/c1-3-21(4-2)28(23,24)16-8-5-7-15(13-16)17-19-22(18(26)25-17)14-20-9-6-11-27-12-10-20/h5,7-8,13H,3-4,6,9-12,14H2,1-2H3 |
| InChIKey | ASRGLWRZBIELKZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 71.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|