C15H23N5O3S2 — CID 24587317
N,N-diethyl-2-(morpholin-4-ylmethyl)-3-sulfanylidene-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide (PubChem CID 24587317) has the molecular formula C15H23N5O3S2 and a molecular weight of 385.52 g/mol. Its IUPAC name is N,N-diethyl-2-(morpholin-4-ylmethyl)-3-sulfanylidene-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide.
| Compound Name | N,N-diethyl-2-(morpholin-4-ylmethyl)-3-sulfanylidene-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide |
|---|---|
| PubChem CID | 24587317 |
| Molecular Formula | C15H23N5O3S2 |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | N,N-diethyl-2-(morpholin-4-ylmethyl)-3-sulfanylidene-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2nn(CN3CCOCC3)c(=S)n2c1 |
| InChI | InChI=1S/C15H23N5O3S2/c1-3-18(4-2)25(21,22)13-5-6-14-16-20(15(24)19(14)11-13)12-17-7-9-23-10-8-17/h5-6,11H,3-4,7-10,12H2,1-2H3 |
| InChIKey | QMHCXTOMIYMPNJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 72.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|