C15H20N4OS — CID 801272
5-benzyl-4-methyl-2-(morpholin-4-ylmethyl)-1,2,4-triazole-3-thione (PubChem CID 801272) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is 5-benzyl-4-methyl-2-(morpholin-4-ylmethyl)-1,2,4-triazole-3-thione.
| Compound Name | 5-benzyl-4-methyl-2-(morpholin-4-ylmethyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 801272 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 5-benzyl-4-methyl-2-(morpholin-4-ylmethyl)-1,2,4-triazole-3-thione |
| SMILES | Cn1c(Cc2ccccc2)nn(CN2CCOCC2)c1=S |
| InChI | InChI=1S/C15H20N4OS/c1-17-14(11-13-5-3-2-4-6-13)16-19(15(17)21)12-18-7-9-20-10-8-18/h2-6H,7-12H2,1H3 |
| InChIKey | VHXVUUPGELMHRG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 35.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|