C25H32N6OS — CID 31131872
2-[[4-[(3-methylphenyl)methyl]piperazin-1-yl]methyl]-5-morpholin-4-yl-4-phenyl-1,2,4-triazole-3-thione (PubChem CID 31131872) has the molecular formula C25H32N6OS and a molecular weight of 464.64 g/mol. Its IUPAC name is 2-[[4-[(3-methylphenyl)methyl]piperazin-1-yl]methyl]-5-morpholin-4-yl-4-phenyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[4-[(3-methylphenyl)methyl]piperazin-1-yl]methyl]-5-morpholin-4-yl-4-phenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 31131872 |
| Molecular Formula | C25H32N6OS |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | 2-[[4-[(3-methylphenyl)methyl]piperazin-1-yl]methyl]-5-morpholin-4-yl-4-phenyl-1,2,4-triazole-3-thione |
| SMILES | Cc1cccc(CN2CCN(Cn3nc(N4CCOCC4)n(-c4ccccc4)c3=S)CC2)c1 |
| InChI | InChI=1S/C25H32N6OS/c1-21-6-5-7-22(18-21)19-27-10-12-28(13-11-27)20-30-25(33)31(23-8-3-2-4-9-23)24(26-30)29-14-16-32-17-15-29/h2-9,18H,10-17,19-20H2,1H3 |
| InChIKey | ZUCVYKXOOBLCNG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 41.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|