C21H26N6OS — CID 9171552
1-(4-methoxyphenyl)-4-[[4-[(3-methylphenyl)methyl]piperazin-1-yl]methyl]tetrazole-5-thione (PubChem CID 9171552) has the molecular formula C21H26N6OS and a molecular weight of 410.55 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-4-[[4-[(3-methylphenyl)methyl]piperazin-1-yl]methyl]tetrazole-5-thione.
| Compound Name | 1-(4-methoxyphenyl)-4-[[4-[(3-methylphenyl)methyl]piperazin-1-yl]methyl]tetrazole-5-thione |
|---|---|
| PubChem CID | 9171552 |
| Molecular Formula | C21H26N6OS |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 1-(4-methoxyphenyl)-4-[[4-[(3-methylphenyl)methyl]piperazin-1-yl]methyl]tetrazole-5-thione |
| SMILES | COc1ccc(-n2nnn(CN3CCN(Cc4cccc(C)c4)CC3)c2=S)cc1 |
| InChI | InChI=1S/C21H26N6OS/c1-17-4-3-5-18(14-17)15-24-10-12-25(13-11-24)16-26-21(29)27(23-22-26)19-6-8-20(28-2)9-7-19/h3-9,14H,10-13,15-16H2,1-2H3 |
| InChIKey | LGUFTJYOJNOXSP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 51.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|