C20H24N6 — CID 34127088
1-[(3-methylphenyl)methyl]-4-[(1-phenyltetrazol-5-yl)methyl]piperazine (PubChem CID 34127088) has the molecular formula C20H24N6 and a molecular weight of 348.45 g/mol. Its IUPAC name is 1-[(3-methylphenyl)methyl]-4-[(1-phenyltetrazol-5-yl)methyl]piperazine.
| Compound Name | 1-[(3-methylphenyl)methyl]-4-[(1-phenyltetrazol-5-yl)methyl]piperazine |
|---|---|
| PubChem CID | 34127088 |
| Molecular Formula | C20H24N6 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 1-[(3-methylphenyl)methyl]-4-[(1-phenyltetrazol-5-yl)methyl]piperazine |
| SMILES | Cc1cccc(CN2CCN(Cc3nnnn3-c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C20H24N6/c1-17-6-5-7-18(14-17)15-24-10-12-25(13-11-24)16-20-21-22-23-26(20)19-8-3-2-4-9-19/h2-9,14H,10-13,15-16H2,1H3 |
| InChIKey | XPXZRMNWINETRR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |