C12H15N5O2 — CID 79410432
(3R,4S)-1-[(1-phenyltetrazol-5-yl)methyl]pyrrolidine-3,4-diol (PubChem CID 79410432) has the molecular formula C12H15N5O2 and a molecular weight of 261.28 g/mol. Its IUPAC name is (3R,4S)-1-[(1-phenyltetrazol-5-yl)methyl]pyrrolidine-3,4-diol.
| Compound Name | (3R,4S)-1-[(1-phenyltetrazol-5-yl)methyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 79410432 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | (3R,4S)-1-[(1-phenyltetrazol-5-yl)methyl]pyrrolidine-3,4-diol |
| SMILES | O[C@@H]1CN(Cc2nnnn2-c2ccccc2)C[C@@H]1O |
| InChI | InChI=1S/C12H15N5O2/c18-10-6-16(7-11(10)19)8-12-13-14-15-17(12)9-4-2-1-3-5-9/h1-5,10-11,18-19H,6-8H2/t10-,11+ |
| InChIKey | ABKLTVYZKADRGO-PHIMTYICSA-N |
| XLogP | -0.80 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |