C19H22N6 — CID 18124637
1-(3-methylphenyl)-4-[(1-phenyltetrazol-5-yl)methyl]piperazine (PubChem CID 18124637) has the molecular formula C19H22N6 and a molecular weight of 334.43 g/mol. Its IUPAC name is 1-(3-methylphenyl)-4-[(1-phenyltetrazol-5-yl)methyl]piperazine.
| Compound Name | 1-(3-methylphenyl)-4-[(1-phenyltetrazol-5-yl)methyl]piperazine |
|---|---|
| PubChem CID | 18124637 |
| Molecular Formula | C19H22N6 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 1-(3-methylphenyl)-4-[(1-phenyltetrazol-5-yl)methyl]piperazine |
| SMILES | Cc1cccc(N2CCN(Cc3nnnn3-c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C19H22N6/c1-16-6-5-9-18(14-16)24-12-10-23(11-13-24)15-19-20-21-22-25(19)17-7-3-2-4-8-17/h2-9,14H,10-13,15H2,1H3 |
| InChIKey | HAWLNQZNOIQNLU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |