C14H20N6 — CID 96668613
1-[[1-(3,5-dimethylphenyl)tetrazol-5-yl]methyl]piperazine (PubChem CID 96668613) has the molecular formula C14H20N6 and a molecular weight of 272.36 g/mol. Its IUPAC name is 1-[[1-(3,5-dimethylphenyl)tetrazol-5-yl]methyl]piperazine.
| Compound Name | 1-[[1-(3,5-dimethylphenyl)tetrazol-5-yl]methyl]piperazine |
|---|---|
| PubChem CID | 96668613 |
| Molecular Formula | C14H20N6 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 1-[[1-(3,5-dimethylphenyl)tetrazol-5-yl]methyl]piperazine |
| SMILES | Cc1cc(C)cc(-n2nnnc2CN2CCNCC2)c1 |
| InChI | InChI=1S/C14H20N6/c1-11-7-12(2)9-13(8-11)20-14(16-17-18-20)10-19-5-3-15-4-6-19/h7-9,15H,3-6,10H2,1-2H3 |
| InChIKey | GSIPKKRWNIZGOW-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |