C18H19ClN6O2S — CID 30858508
1-(2-chlorophenyl)sulfonyl-4-[(1-phenyltetrazol-5-yl)methyl]piperazine (PubChem CID 30858508) has the molecular formula C18H19ClN6O2S and a molecular weight of 418.91 g/mol. Its IUPAC name is 1-(2-chlorophenyl)sulfonyl-4-[(1-phenyltetrazol-5-yl)methyl]piperazine.
| Compound Name | 1-(2-chlorophenyl)sulfonyl-4-[(1-phenyltetrazol-5-yl)methyl]piperazine |
|---|---|
| PubChem CID | 30858508 |
| Molecular Formula | C18H19ClN6O2S |
| Molecular Weight | 418.91 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 1-(2-chlorophenyl)sulfonyl-4-[(1-phenyltetrazol-5-yl)methyl]piperazine |
| SMILES | O=S(=O)(c1ccccc1Cl)N1CCN(Cc2nnnn2-c2ccccc2)CC1 |
| InChI | InChI=1S/C18H19ClN6O2S/c19-16-8-4-5-9-17(16)28(26,27)24-12-10-23(11-13-24)14-18-20-21-22-25(18)15-6-2-1-3-7-15/h1-9H,10-14H2 |
| InChIKey | MAQRKTVHSIQAPS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.91 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |