C20H23FN6OS — CID 9330481
1-[[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]methyl]-4-phenyltetrazole-5-thione (PubChem CID 9330481) has the molecular formula C20H23FN6OS and a molecular weight of 414.51 g/mol. Its IUPAC name is 1-[[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]methyl]-4-phenyltetrazole-5-thione.
| Compound Name | 1-[[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]methyl]-4-phenyltetrazole-5-thione |
|---|---|
| PubChem CID | 9330481 |
| Molecular Formula | C20H23FN6OS |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 1-[[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]methyl]-4-phenyltetrazole-5-thione |
| SMILES | COc1ccc(F)cc1CN1CCN(Cn2nnn(-c3ccccc3)c2=S)CC1 |
| InChI | InChI=1S/C20H23FN6OS/c1-28-19-8-7-17(21)13-16(19)14-24-9-11-25(12-10-24)15-26-20(29)27(23-22-26)18-5-3-2-4-6-18/h2-8,13H,9-12,14-15H2,1H3 |
| InChIKey | JZSGAOPXNDMKHT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 51.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|