C18H20ClFN2O3S — CID 38749302
1-(2-chlorophenyl)sulfonyl-4-[(5-fluoro-2-methoxyphenyl)methyl]piperazine (PubChem CID 38749302) has the molecular formula C18H20ClFN2O3S and a molecular weight of 398.89 g/mol. Its IUPAC name is 1-(2-chlorophenyl)sulfonyl-4-[(5-fluoro-2-methoxyphenyl)methyl]piperazine.
| Compound Name | 1-(2-chlorophenyl)sulfonyl-4-[(5-fluoro-2-methoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 38749302 |
| Molecular Formula | C18H20ClFN2O3S |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 1-(2-chlorophenyl)sulfonyl-4-[(5-fluoro-2-methoxyphenyl)methyl]piperazine |
| SMILES | COc1ccc(F)cc1CN1CCN(S(=O)(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C18H20ClFN2O3S/c1-25-17-7-6-15(20)12-14(17)13-21-8-10-22(11-9-21)26(23,24)18-5-3-2-4-16(18)19/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | UJTCARKARARZPK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |