C20H19ClFN3O2S — CID 55625872
8-[[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]methyl]-6-fluoroquinoline (PubChem CID 55625872) has the molecular formula C20H19ClFN3O2S and a molecular weight of 419.91 g/mol. Its IUPAC name is 8-[[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]methyl]-6-fluoroquinoline.
| Compound Name | 8-[[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]methyl]-6-fluoroquinoline |
|---|---|
| PubChem CID | 55625872 |
| Molecular Formula | C20H19ClFN3O2S |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 8-[[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]methyl]-6-fluoroquinoline |
| SMILES | O=S(=O)(c1ccccc1Cl)N1CCN(Cc2cc(F)cc3cccnc23)CC1 |
| InChI | InChI=1S/C20H19ClFN3O2S/c21-18-5-1-2-6-19(18)28(26,27)25-10-8-24(9-11-25)14-16-13-17(22)12-15-4-3-7-23-20(15)16/h1-7,12-13H,8-11,14H2 |
| InChIKey | YWHKRFSHBKDMGM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |