C20H18F3N3O2S — CID 46405422
8-[[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]methyl]-6-fluoroquinoline (PubChem CID 46405422) has the molecular formula C20H18F3N3O2S and a molecular weight of 421.44 g/mol. Its IUPAC name is 8-[[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]methyl]-6-fluoroquinoline.
| Compound Name | 8-[[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]methyl]-6-fluoroquinoline |
|---|---|
| PubChem CID | 46405422 |
| Molecular Formula | C20H18F3N3O2S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 8-[[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]methyl]-6-fluoroquinoline |
| SMILES | O=S(=O)(c1c(F)cccc1F)N1CCN(Cc2cc(F)cc3cccnc23)CC1 |
| InChI | InChI=1S/C20H18F3N3O2S/c21-16-11-14-3-2-6-24-19(14)15(12-16)13-25-7-9-26(10-8-25)29(27,28)20-17(22)4-1-5-18(20)23/h1-6,11-12H,7-10,13H2 |
| InChIKey | FFKXXUDRAJLRSE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |