C20H21FN4O4S2 — CID 55625793
4-[4-[(6-fluoroquinolin-8-yl)methyl]piperazin-1-yl]sulfonylbenzenesulfonamide (PubChem CID 55625793) has the molecular formula C20H21FN4O4S2 and a molecular weight of 464.54 g/mol. Its IUPAC name is 4-[4-[(6-fluoroquinolin-8-yl)methyl]piperazin-1-yl]sulfonylbenzenesulfonamide.
| Compound Name | 4-[4-[(6-fluoroquinolin-8-yl)methyl]piperazin-1-yl]sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 55625793 |
| Molecular Formula | C20H21FN4O4S2 |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 4-[4-[(6-fluoroquinolin-8-yl)methyl]piperazin-1-yl]sulfonylbenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(S(=O)(=O)N2CCN(Cc3cc(F)cc4cccnc34)CC2)cc1 |
| InChI | InChI=1S/C20H21FN4O4S2/c21-17-12-15-2-1-7-23-20(15)16(13-17)14-24-8-10-25(11-9-24)31(28,29)19-5-3-18(4-6-19)30(22,26)27/h1-7,12-13H,8-11,14H2,(H2,22,26,27) |
| InChIKey | UBVGLCQUPCLCIN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |