C21H22ClN3O4S2 — CID 55598876
8-[[4-(2-chloro-5-methylsulfonylphenyl)sulfonylpiperazin-1-yl]methyl]quinoline (PubChem CID 55598876) has the molecular formula C21H22ClN3O4S2 and a molecular weight of 480.01 g/mol. Its IUPAC name is 8-[[4-(2-chloro-5-methylsulfonylphenyl)sulfonylpiperazin-1-yl]methyl]quinoline.
| Compound Name | 8-[[4-(2-chloro-5-methylsulfonylphenyl)sulfonylpiperazin-1-yl]methyl]quinoline |
|---|---|
| PubChem CID | 55598876 |
| Molecular Formula | C21H22ClN3O4S2 |
| Molecular Weight | 480.01 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | 8-[[4-(2-chloro-5-methylsulfonylphenyl)sulfonylpiperazin-1-yl]methyl]quinoline |
| SMILES | CS(=O)(=O)c1ccc(Cl)c(S(=O)(=O)N2CCN(Cc3cccc4cccnc34)CC2)c1 |
| InChI | InChI=1S/C21H22ClN3O4S2/c1-30(26,27)18-7-8-19(22)20(14-18)31(28,29)25-12-10-24(11-13-25)15-17-5-2-4-16-6-3-9-23-21(16)17/h2-9,14H,10-13,15H2,1H3 |
| InChIKey | ZBIXGNVBUGMJOQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.01 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |