C26H34N6OS — CID 22109137
4-benzyl-2-[[4-[(2-methylphenyl)methyl]piperazin-1-yl]methyl]-5-morpholin-4-yl-1,2,4-triazole-3-thione (PubChem CID 22109137) has the molecular formula C26H34N6OS and a molecular weight of 478.67 g/mol. Its IUPAC name is 4-benzyl-2-[[4-[(2-methylphenyl)methyl]piperazin-1-yl]methyl]-5-morpholin-4-yl-1,2,4-triazole-3-thione.
| Compound Name | 4-benzyl-2-[[4-[(2-methylphenyl)methyl]piperazin-1-yl]methyl]-5-morpholin-4-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 22109137 |
| Molecular Formula | C26H34N6OS |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | 4-benzyl-2-[[4-[(2-methylphenyl)methyl]piperazin-1-yl]methyl]-5-morpholin-4-yl-1,2,4-triazole-3-thione |
| SMILES | Cc1ccccc1CN1CCN(Cn2nc(N3CCOCC3)n(Cc3ccccc3)c2=S)CC1 |
| InChI | InChI=1S/C26H34N6OS/c1-22-7-5-6-10-24(22)20-28-11-13-29(14-12-28)21-32-26(34)31(19-23-8-3-2-4-9-23)25(27-32)30-15-17-33-18-16-30/h2-10H,11-21H2,1H3 |
| InChIKey | AZZJMVFWPRJGKT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 41.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|