C24H35N5OS — CID 47089136
4-benzyl-2-[[cyclohexylmethyl(cyclopropyl)amino]methyl]-5-morpholin-4-yl-1,2,4-triazole-3-thione (PubChem CID 47089136) has the molecular formula C24H35N5OS and a molecular weight of 441.65 g/mol. Its IUPAC name is 4-benzyl-2-[[cyclohexylmethyl(cyclopropyl)amino]methyl]-5-morpholin-4-yl-1,2,4-triazole-3-thione.
| Compound Name | 4-benzyl-2-[[cyclohexylmethyl(cyclopropyl)amino]methyl]-5-morpholin-4-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 47089136 |
| Molecular Formula | C24H35N5OS |
| Molecular Weight | 441.65 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | 4-benzyl-2-[[cyclohexylmethyl(cyclopropyl)amino]methyl]-5-morpholin-4-yl-1,2,4-triazole-3-thione |
| SMILES | S=c1n(CN(CC2CCCCC2)C2CC2)nc(N2CCOCC2)n1Cc1ccccc1 |
| InChI | InChI=1S/C24H35N5OS/c31-24-28(18-21-9-5-2-6-10-21)23(26-13-15-30-16-14-26)25-29(24)19-27(22-11-12-22)17-20-7-3-1-4-8-20/h2,5-6,9-10,20,22H,1,3-4,7-8,11-19H2 |
| InChIKey | MTVIZLCKHKRQIW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 38.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.65 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|