C22H28N4S2 — CID 7911188
2-[(4-methylpiperidin-1-yl)methyl]-4-(2-phenylethyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazole-3-thione (PubChem CID 7911188) has the molecular formula C22H28N4S2 and a molecular weight of 412.63 g/mol. Its IUPAC name is 2-[(4-methylpiperidin-1-yl)methyl]-4-(2-phenylethyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazole-3-thione.
| Compound Name | 2-[(4-methylpiperidin-1-yl)methyl]-4-(2-phenylethyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 7911188 |
| Molecular Formula | C22H28N4S2 |
| Molecular Weight | 412.63 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 2-[(4-methylpiperidin-1-yl)methyl]-4-(2-phenylethyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazole-3-thione |
| SMILES | CC1CCN(Cn2nc(Cc3cccs3)n(CCc3ccccc3)c2=S)CC1 |
| InChI | InChI=1S/C22H28N4S2/c1-18-9-12-24(13-10-18)17-26-22(27)25(14-11-19-6-3-2-4-7-19)21(23-26)16-20-8-5-15-28-20/h2-8,15,18H,9-14,16-17H2,1H3 |
| InChIKey | LUINUMPHNGFUEK-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.63 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|