C16H19N5S2 — CID 43029562
2-[[4-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione (PubChem CID 43029562) has the molecular formula C16H19N5S2 and a molecular weight of 345.50 g/mol. Its IUPAC name is 2-[[4-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione.
| Compound Name | 2-[[4-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione |
|---|---|
| PubChem CID | 43029562 |
| Molecular Formula | C16H19N5S2 |
| Molecular Weight | 345.50 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 2-[[4-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione |
| SMILES | S=c1n(CN2CCN(Cc3cccs3)CC2)nc2ccccn12 |
| InChI | InChI=1S/C16H19N5S2/c22-16-20-6-2-1-5-15(20)17-21(16)13-19-9-7-18(8-10-19)12-14-4-3-11-23-14/h1-6,11H,7-10,12-13H2 |
| InChIKey | VNHFUBLYFYIVCP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 28.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|