C18H19N5S3 — CID 46815897
2-[[4-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]-[1,2,4]triazolo[3,4-b][1,3]benzothiazole-1-thione (PubChem CID 46815897) has the molecular formula C18H19N5S3 and a molecular weight of 401.59 g/mol. Its IUPAC name is 2-[[4-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]-[1,2,4]triazolo[3,4-b][1,3]benzothiazole-1-thione.
| Compound Name | 2-[[4-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]-[1,2,4]triazolo[3,4-b][1,3]benzothiazole-1-thione |
|---|---|
| PubChem CID | 46815897 |
| Molecular Formula | C18H19N5S3 |
| Molecular Weight | 401.59 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 2-[[4-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]-[1,2,4]triazolo[3,4-b][1,3]benzothiazole-1-thione |
| SMILES | S=c1n(CN2CCN(Cc3cccs3)CC2)nc2sc3ccccc3n12 |
| InChI | InChI=1S/C18H19N5S3/c24-18-22(19-17-23(18)15-5-1-2-6-16(15)26-17)13-21-9-7-20(8-10-21)12-14-4-3-11-25-14/h1-6,11H,7-10,12-13H2 |
| InChIKey | CMHUKHBTMANTGY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 28.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.59 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|