C17H19N3S3 — CID 30245525
3-[[4-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]-1,3-benzothiazole-2-thione (PubChem CID 30245525) has the molecular formula C17H19N3S3 and a molecular weight of 361.56 g/mol. Its IUPAC name is 3-[[4-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]-1,3-benzothiazole-2-thione.
| Compound Name | 3-[[4-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]-1,3-benzothiazole-2-thione |
|---|---|
| PubChem CID | 30245525 |
| Molecular Formula | C17H19N3S3 |
| Molecular Weight | 361.56 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 3-[[4-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]-1,3-benzothiazole-2-thione |
| SMILES | S=c1sc2ccccc2n1CN1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C17H19N3S3/c21-17-20(15-5-1-2-6-16(15)23-17)13-19-9-7-18(8-10-19)12-14-4-3-11-22-14/h1-6,11H,7-10,12-13H2 |
| InChIKey | QVFZHVMMECLBQA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|