C21H22N6S — CID 17466260
2-[[4-(quinolin-8-ylmethyl)piperazin-1-yl]methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione (PubChem CID 17466260) has the molecular formula C21H22N6S and a molecular weight of 390.52 g/mol. Its IUPAC name is 2-[[4-(quinolin-8-ylmethyl)piperazin-1-yl]methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione.
| Compound Name | 2-[[4-(quinolin-8-ylmethyl)piperazin-1-yl]methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione |
|---|---|
| PubChem CID | 17466260 |
| Molecular Formula | C21H22N6S |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 2-[[4-(quinolin-8-ylmethyl)piperazin-1-yl]methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione |
| SMILES | S=c1n(CN2CCN(Cc3cccc4cccnc34)CC2)nc2ccccn12 |
| InChI | InChI=1S/C21H22N6S/c28-21-26-10-2-1-8-19(26)23-27(21)16-25-13-11-24(12-14-25)15-18-6-3-5-17-7-4-9-22-20(17)18/h1-10H,11-16H2 |
| InChIKey | LVMVPQLKNGXKQG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 41.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|