C16H22N4OS2 — CID 2480344
4-[[(2R)-oxolan-2-yl]methyl]-2-(pyrrolidin-1-ylmethyl)-5-thiophen-2-yl-1,2,4-triazole-3-thione (PubChem CID 2480344) has the molecular formula C16H22N4OS2 and a molecular weight of 350.51 g/mol. Its IUPAC name is 4-[[(2R)-oxolan-2-yl]methyl]-2-(pyrrolidin-1-ylmethyl)-5-thiophen-2-yl-1,2,4-triazole-3-thione.
| Compound Name | 4-[[(2R)-oxolan-2-yl]methyl]-2-(pyrrolidin-1-ylmethyl)-5-thiophen-2-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 2480344 |
| Molecular Formula | C16H22N4OS2 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 4-[[(2R)-oxolan-2-yl]methyl]-2-(pyrrolidin-1-ylmethyl)-5-thiophen-2-yl-1,2,4-triazole-3-thione |
| SMILES | S=c1n(CN2CCCC2)nc(-c2cccs2)n1C[C@H]1CCCO1 |
| InChI | InChI=1S/C16H22N4OS2/c22-16-19(11-13-5-3-9-21-13)15(14-6-4-10-23-14)17-20(16)12-18-7-1-2-8-18/h4,6,10,13H,1-3,5,7-9,11-12H2/t13-/m1/s1 |
| InChIKey | ZXCYNYDYTUCQMM-CYBMUJFWSA-N |
| XLogP | 3.37 |
| TPSA | 35.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|