C16H23N4O2S2+ — CID 8019617
2-(morpholin-4-ium-4-ylmethyl)-4-[[(2R)-oxolan-2-yl]methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione (PubChem CID 8019617) has the molecular formula C16H23N4O2S2+ and a molecular weight of 367.52 g/mol. Its IUPAC name is 2-(morpholin-4-ium-4-ylmethyl)-4-[[(2R)-oxolan-2-yl]methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione.
| Compound Name | 2-(morpholin-4-ium-4-ylmethyl)-4-[[(2R)-oxolan-2-yl]methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 8019617 |
| Molecular Formula | C16H23N4O2S2+ |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 2-(morpholin-4-ium-4-ylmethyl)-4-[[(2R)-oxolan-2-yl]methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione |
| SMILES | S=c1n(C[NH+]2CCOCC2)nc(-c2cccs2)n1C[C@H]1CCCO1 |
| InChI | InChI=1S/C16H22N4O2S2/c23-16-19(11-13-3-1-7-22-13)15(14-4-2-10-24-14)17-20(16)12-18-5-8-21-9-6-18/h2,4,10,13H,1,3,5-9,11-12H2/p+1/t13-/m1/s1 |
| InChIKey | YPEUNHHKQXMJAL-CYBMUJFWSA-O |
| XLogP | 1.19 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|