C20H26N5OS2+ — CID 2106143
4-ethyl-2-[[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione (PubChem CID 2106143) has the molecular formula C20H26N5OS2+ and a molecular weight of 416.60 g/mol. Its IUPAC name is 4-ethyl-2-[[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione.
| Compound Name | 4-ethyl-2-[[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 2106143 |
| Molecular Formula | C20H26N5OS2+ |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 4-ethyl-2-[[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione |
| SMILES | CCn1c(-c2cccs2)nn(C[NH+]2CCN(c3ccc(OC)cc3)CC2)c1=S |
| InChI | InChI=1S/C20H25N5OS2/c1-3-24-19(18-5-4-14-28-18)21-25(20(24)27)15-22-10-12-23(13-11-22)16-6-8-17(26-2)9-7-16/h4-9,14H,3,10-13,15H2,1-2H3/p+1 |
| InChIKey | FZRLTLGSFBGRHK-UHFFFAOYSA-O |
| XLogP | 2.53 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|