C18H21N4S2+ — CID 7479799
4-phenyl-2-(piperidin-1-ium-1-ylmethyl)-5-thiophen-2-yl-1,2,4-triazole-3-thione (PubChem CID 7479799) has the molecular formula C18H21N4S2+ and a molecular weight of 357.53 g/mol. Its IUPAC name is 4-phenyl-2-(piperidin-1-ium-1-ylmethyl)-5-thiophen-2-yl-1,2,4-triazole-3-thione.
| Compound Name | 4-phenyl-2-(piperidin-1-ium-1-ylmethyl)-5-thiophen-2-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 7479799 |
| Molecular Formula | C18H21N4S2+ |
| Molecular Weight | 357.53 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 4-phenyl-2-(piperidin-1-ium-1-ylmethyl)-5-thiophen-2-yl-1,2,4-triazole-3-thione |
| SMILES | S=c1n(C[NH+]2CCCCC2)nc(-c2cccs2)n1-c1ccccc1 |
| InChI | InChI=1S/C18H20N4S2/c23-18-21(14-20-11-5-2-6-12-20)19-17(16-10-7-13-24-16)22(18)15-8-3-1-4-9-15/h1,3-4,7-10,13H,2,5-6,11-12,14H2/p+1 |
| InChIKey | WKQYBCPDLXYBSU-UHFFFAOYSA-O |
| XLogP | 3.16 |
| TPSA | 27.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|