C20H25N4OS2+ — CID 7479894
4-(2-methoxyphenyl)-2-[[(3S)-3-methylpiperidin-1-ium-1-yl]methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione (PubChem CID 7479894) has the molecular formula C20H25N4OS2+ and a molecular weight of 401.58 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-2-[[(3S)-3-methylpiperidin-1-ium-1-yl]methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione.
| Compound Name | 4-(2-methoxyphenyl)-2-[[(3S)-3-methylpiperidin-1-ium-1-yl]methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 7479894 |
| Molecular Formula | C20H25N4OS2+ |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 4-(2-methoxyphenyl)-2-[[(3S)-3-methylpiperidin-1-ium-1-yl]methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione |
| SMILES | COc1ccccc1-n1c(-c2cccs2)nn(C[NH+]2CCC[C@H](C)C2)c1=S |
| InChI | InChI=1S/C20H24N4OS2/c1-15-7-5-11-22(13-15)14-23-20(26)24(16-8-3-4-9-17(16)25-2)19(21-23)18-10-6-12-27-18/h3-4,6,8-10,12,15H,5,7,11,13-14H2,1-2H3/p+1/t15-/m0/s1 |
| InChIKey | ZSSBTUDLSAFPPH-HNNXBMFYSA-O |
| XLogP | 3.41 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|