C20H17N3O2S — CID 118541876
4-(2-methoxyphenyl)-3-phenylmethoxy-5-thiophen-2-yl-1,2,4-triazole (PubChem CID 118541876) has the molecular formula C20H17N3O2S and a molecular weight of 363.44 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-3-phenylmethoxy-5-thiophen-2-yl-1,2,4-triazole.
| Compound Name | 4-(2-methoxyphenyl)-3-phenylmethoxy-5-thiophen-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 118541876 |
| Molecular Formula | C20H17N3O2S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 4-(2-methoxyphenyl)-3-phenylmethoxy-5-thiophen-2-yl-1,2,4-triazole |
| SMILES | COc1ccccc1-n1c(OCc2ccccc2)nnc1-c1cccs1 |
| InChI | InChI=1S/C20H17N3O2S/c1-24-17-11-6-5-10-16(17)23-19(18-12-7-13-26-18)21-22-20(23)25-14-15-8-3-2-4-9-15/h2-13H,14H2,1H3 |
| InChIKey | XZSHWNBFEKQWEZ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |