C21H19ClN4OS2 — CID 155197398
N-[2-(4-chlorophenyl)ethylsulfanyl]-4-(2-methoxyphenyl)-5-thiophen-2-yl-1,2,4-triazol-3-amine (PubChem CID 155197398) has the molecular formula C21H19ClN4OS2 and a molecular weight of 443.00 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethylsulfanyl]-4-(2-methoxyphenyl)-5-thiophen-2-yl-1,2,4-triazol-3-amine.
| Compound Name | N-[2-(4-chlorophenyl)ethylsulfanyl]-4-(2-methoxyphenyl)-5-thiophen-2-yl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 155197398 |
| Molecular Formula | C21H19ClN4OS2 |
| Molecular Weight | 443.00 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethylsulfanyl]-4-(2-methoxyphenyl)-5-thiophen-2-yl-1,2,4-triazol-3-amine |
| SMILES | COc1ccccc1-n1c(NSCCc2ccc(Cl)cc2)nnc1-c1cccs1 |
| InChI | InChI=1S/C21H19ClN4OS2/c1-27-18-6-3-2-5-17(18)26-20(19-7-4-13-28-19)23-24-21(26)25-29-14-12-15-8-10-16(22)11-9-15/h2-11,13H,12,14H2,1H3,(H,24,25) |
| InChIKey | BWRPSCFJRZIQTO-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.00 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|