C22H22ClN5O2S2 — CID 142359501
N-[2-(4-chlorophenyl)ethylsulfanyl]-4-(2,6-dimethoxyphenyl)-5-(5-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-amine (PubChem CID 142359501) has the molecular formula C22H22ClN5O2S2 and a molecular weight of 488.04 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethylsulfanyl]-4-(2,6-dimethoxyphenyl)-5-(5-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-amine.
| Compound Name | N-[2-(4-chlorophenyl)ethylsulfanyl]-4-(2,6-dimethoxyphenyl)-5-(5-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 142359501 |
| Molecular Formula | C22H22ClN5O2S2 |
| Molecular Weight | 488.04 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethylsulfanyl]-4-(2,6-dimethoxyphenyl)-5-(5-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-amine |
| SMILES | COc1cccc(OC)c1-n1c(NSCCc2ccc(Cl)cc2)nnc1-c1ncc(C)s1 |
| InChI | InChI=1S/C22H22ClN5O2S2/c1-14-13-24-21(32-14)20-25-26-22(27-31-12-11-15-7-9-16(23)10-8-15)28(20)19-17(29-2)5-4-6-18(19)30-3/h4-10,13H,11-12H2,1-3H3,(H,26,27) |
| InChIKey | QQTXJNZLMGGFEC-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.04 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|