C22H24FN7O2S2 — CID 142359535
4-(2,6-dimethoxyphenyl)-N-[2-(5-fluoropyrimidin-2-yl)ethylsulfanyl]-5-(4-propan-2-yl-1,3-thiazol-2-yl)-1,2,4-triazol-3-amine (PubChem CID 142359535) has the molecular formula C22H24FN7O2S2 and a molecular weight of 501.61 g/mol. Its IUPAC name is 4-(2,6-dimethoxyphenyl)-N-[2-(5-fluoropyrimidin-2-yl)ethylsulfanyl]-5-(4-propan-2-yl-1,3-thiazol-2-yl)-1,2,4-triazol-3-amine.
| Compound Name | 4-(2,6-dimethoxyphenyl)-N-[2-(5-fluoropyrimidin-2-yl)ethylsulfanyl]-5-(4-propan-2-yl-1,3-thiazol-2-yl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 142359535 |
| Molecular Formula | C22H24FN7O2S2 |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | 4-(2,6-dimethoxyphenyl)-N-[2-(5-fluoropyrimidin-2-yl)ethylsulfanyl]-5-(4-propan-2-yl-1,3-thiazol-2-yl)-1,2,4-triazol-3-amine |
| SMILES | COc1cccc(OC)c1-n1c(NSCCc2ncc(F)cn2)nnc1-c1nc(C(C)C)cs1 |
| InChI | InChI=1S/C22H24FN7O2S2/c1-13(2)15-12-33-21(26-15)20-27-28-22(29-34-9-8-18-24-10-14(23)11-25-18)30(20)19-16(31-3)6-5-7-17(19)32-4/h5-7,10-13H,8-9H2,1-4H3,(H,28,29) |
| InChIKey | NKECCSUIMFNIJH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|