C22H24N6O2S2 — CID 145191520
4-(2,6-dimethoxyphenyl)-5-(5-methyl-3-pyridinyl)-N-[2-(4-methyl-1,3-thiazol-2-yl)ethylsulfanyl]-1,2,4-triazol-3-amine (PubChem CID 145191520) has the molecular formula C22H24N6O2S2 and a molecular weight of 468.61 g/mol. Its IUPAC name is 4-(2,6-dimethoxyphenyl)-5-(5-methyl-3-pyridinyl)-N-[2-(4-methyl-1,3-thiazol-2-yl)ethylsulfanyl]-1,2,4-triazol-3-amine.
| Compound Name | 4-(2,6-dimethoxyphenyl)-5-(5-methyl-3-pyridinyl)-N-[2-(4-methyl-1,3-thiazol-2-yl)ethylsulfanyl]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 145191520 |
| Molecular Formula | C22H24N6O2S2 |
| Molecular Weight | 468.61 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 4-(2,6-dimethoxyphenyl)-5-(5-methyl-3-pyridinyl)-N-[2-(4-methyl-1,3-thiazol-2-yl)ethylsulfanyl]-1,2,4-triazol-3-amine |
| SMILES | COc1cccc(OC)c1-n1c(NSCCc2nc(C)cs2)nnc1-c1cncc(C)c1 |
| InChI | InChI=1S/C22H24N6O2S2/c1-14-10-16(12-23-11-14)21-25-26-22(27-32-9-8-19-24-15(2)13-31-19)28(21)20-17(29-3)6-5-7-18(20)30-4/h5-7,10-13H,8-9H2,1-4H3,(H,26,27) |
| InChIKey | GBNCSDIGCGIAHD-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.61 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|