C23H25N7O3S — CID 145191103
4-(2,6-dimethoxyphenyl)-N-[2-(5-methoxypyrazin-2-yl)ethylsulfanyl]-5-(5-methyl-3-pyridinyl)-1,2,4-triazol-3-amine (PubChem CID 145191103) has the molecular formula C23H25N7O3S and a molecular weight of 479.57 g/mol. Its IUPAC name is 4-(2,6-dimethoxyphenyl)-N-[2-(5-methoxypyrazin-2-yl)ethylsulfanyl]-5-(5-methyl-3-pyridinyl)-1,2,4-triazol-3-amine.
| Compound Name | 4-(2,6-dimethoxyphenyl)-N-[2-(5-methoxypyrazin-2-yl)ethylsulfanyl]-5-(5-methyl-3-pyridinyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 145191103 |
| Molecular Formula | C23H25N7O3S |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 4-(2,6-dimethoxyphenyl)-N-[2-(5-methoxypyrazin-2-yl)ethylsulfanyl]-5-(5-methyl-3-pyridinyl)-1,2,4-triazol-3-amine |
| SMILES | COc1cnc(CCSNc2nnc(-c3cncc(C)c3)n2-c2c(OC)cccc2OC)cn1 |
| InChI | InChI=1S/C23H25N7O3S/c1-15-10-16(12-24-11-15)22-27-28-23(29-34-9-8-17-13-26-20(33-4)14-25-17)30(22)21-18(31-2)6-5-7-19(21)32-3/h5-7,10-14H,8-9H2,1-4H3,(H,28,29) |
| InChIKey | NWTKBSBMZREESQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|