C24H31N5O3S — CID 145190987
N-(1-cyclobutyl-1-methoxypropan-2-yl)sulfanyl-4-(2,6-dimethoxyphenyl)-5-(5-methyl-3-pyridinyl)-1,2,4-triazol-3-amine (PubChem CID 145190987) has the molecular formula C24H31N5O3S and a molecular weight of 469.61 g/mol. Its IUPAC name is N-(1-cyclobutyl-1-methoxypropan-2-yl)sulfanyl-4-(2,6-dimethoxyphenyl)-5-(5-methyl-3-pyridinyl)-1,2,4-triazol-3-amine.
| Compound Name | N-(1-cyclobutyl-1-methoxypropan-2-yl)sulfanyl-4-(2,6-dimethoxyphenyl)-5-(5-methyl-3-pyridinyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 145190987 |
| Molecular Formula | C24H31N5O3S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | N-(1-cyclobutyl-1-methoxypropan-2-yl)sulfanyl-4-(2,6-dimethoxyphenyl)-5-(5-methyl-3-pyridinyl)-1,2,4-triazol-3-amine |
| SMILES | COc1cccc(OC)c1-n1c(NSC(C)C(OC)C2CCC2)nnc1-c1cncc(C)c1 |
| InChI | InChI=1S/C24H31N5O3S/c1-15-12-18(14-25-13-15)23-26-27-24(28-33-16(2)22(32-5)17-8-6-9-17)29(23)21-19(30-3)10-7-11-20(21)31-4/h7,10-14,16-17,22H,6,8-9H2,1-5H3,(H,27,28) |
| InChIKey | WZMJSTDXDXFJIW-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|