C20H19FN8O2S — CID 155197408
4-(2,6-dimethoxyphenyl)-N-[2-(5-fluoropyrimidin-2-yl)ethylsulfanyl]-5-pyrimidin-2-yl-1,2,4-triazol-3-amine (PubChem CID 155197408) has the molecular formula C20H19FN8O2S and a molecular weight of 454.49 g/mol. Its IUPAC name is 4-(2,6-dimethoxyphenyl)-N-[2-(5-fluoropyrimidin-2-yl)ethylsulfanyl]-5-pyrimidin-2-yl-1,2,4-triazol-3-amine.
| Compound Name | 4-(2,6-dimethoxyphenyl)-N-[2-(5-fluoropyrimidin-2-yl)ethylsulfanyl]-5-pyrimidin-2-yl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 155197408 |
| Molecular Formula | C20H19FN8O2S |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 4-(2,6-dimethoxyphenyl)-N-[2-(5-fluoropyrimidin-2-yl)ethylsulfanyl]-5-pyrimidin-2-yl-1,2,4-triazol-3-amine |
| SMILES | COc1cccc(OC)c1-n1c(NSCCc2ncc(F)cn2)nnc1-c1ncccn1 |
| InChI | InChI=1S/C20H19FN8O2S/c1-30-14-5-3-6-15(31-2)17(14)29-19(18-22-8-4-9-23-18)26-27-20(29)28-32-10-7-16-24-11-13(21)12-25-16/h3-6,8-9,11-12H,7,10H2,1-2H3,(H,27,28) |
| InChIKey | ONHQBRMZLAZKBP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|