C19H19FN8O3S — CID 142359667
4-(2,6-dimethoxyphenyl)-N-[2-(5-fluoropyrimidin-2-yl)ethylsulfanyl]-5-(5-methyl-1,3,4-oxadiazol-2-yl)-1,2,4-triazol-3-amine (PubChem CID 142359667) has the molecular formula C19H19FN8O3S and a molecular weight of 458.48 g/mol. Its IUPAC name is 4-(2,6-dimethoxyphenyl)-N-[2-(5-fluoropyrimidin-2-yl)ethylsulfanyl]-5-(5-methyl-1,3,4-oxadiazol-2-yl)-1,2,4-triazol-3-amine.
| Compound Name | 4-(2,6-dimethoxyphenyl)-N-[2-(5-fluoropyrimidin-2-yl)ethylsulfanyl]-5-(5-methyl-1,3,4-oxadiazol-2-yl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 142359667 |
| Molecular Formula | C19H19FN8O3S |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 4-(2,6-dimethoxyphenyl)-N-[2-(5-fluoropyrimidin-2-yl)ethylsulfanyl]-5-(5-methyl-1,3,4-oxadiazol-2-yl)-1,2,4-triazol-3-amine |
| SMILES | COc1cccc(OC)c1-n1c(NSCCc2ncc(F)cn2)nnc1-c1nnc(C)o1 |
| InChI | InChI=1S/C19H19FN8O3S/c1-11-23-25-18(31-11)17-24-26-19(27-32-8-7-15-21-9-12(20)10-22-15)28(17)16-13(29-2)5-4-6-14(16)30-3/h4-6,9-10H,7-8H2,1-3H3,(H,26,27) |
| InChIKey | OAFIVEZTNVYZQY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|