C24H22ClFN4O2S — CID 142353965
N-[2-(4-chlorophenyl)ethylsulfanyl]-4-(2,6-dimethoxyphenyl)-5-(2-fluorophenyl)-1,2,4-triazol-3-amine (PubChem CID 142353965) has the molecular formula C24H22ClFN4O2S and a molecular weight of 484.98 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethylsulfanyl]-4-(2,6-dimethoxyphenyl)-5-(2-fluorophenyl)-1,2,4-triazol-3-amine.
| Compound Name | N-[2-(4-chlorophenyl)ethylsulfanyl]-4-(2,6-dimethoxyphenyl)-5-(2-fluorophenyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 142353965 |
| Molecular Formula | C24H22ClFN4O2S |
| Molecular Weight | 484.98 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethylsulfanyl]-4-(2,6-dimethoxyphenyl)-5-(2-fluorophenyl)-1,2,4-triazol-3-amine |
| SMILES | COc1cccc(OC)c1-n1c(NSCCc2ccc(Cl)cc2)nnc1-c1ccccc1F |
| InChI | InChI=1S/C24H22ClFN4O2S/c1-31-20-8-5-9-21(32-2)22(20)30-23(18-6-3-4-7-19(18)26)27-28-24(30)29-33-15-14-16-10-12-17(25)13-11-16/h3-13H,14-15H2,1-2H3,(H,28,29) |
| InChIKey | CTKUQFDBKDZDHY-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.98 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|