C27H29ClN6O3S — CID 134553077
N-[2-[5-chloro-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-2-pyridinyl]ethylsulfanyl]-4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-amine (PubChem CID 134553077) has the molecular formula C27H29ClN6O3S and a molecular weight of 553.09 g/mol. Its IUPAC name is N-[2-[5-chloro-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-2-pyridinyl]ethylsulfanyl]-4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-amine.
| Compound Name | N-[2-[5-chloro-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-2-pyridinyl]ethylsulfanyl]-4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 134553077 |
| Molecular Formula | C27H29ClN6O3S |
| Molecular Weight | 553.09 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | N-[2-[5-chloro-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-2-pyridinyl]ethylsulfanyl]-4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-amine |
| SMILES | COc1cccc(OC)c1-n1c(NSCCc2ncc(Cl)cc2C2=CCN(C)CC2)nnc1-c1ccco1 |
| InChI | InChI=1S/C27H29ClN6O3S/c1-33-12-9-18(10-13-33)20-16-19(28)17-29-21(20)11-15-38-32-27-31-30-26(24-8-5-14-37-24)34(27)25-22(35-2)6-4-7-23(25)36-3/h4-9,14,16-17H,10-13,15H2,1-3H3,(H,31,32) |
| InChIKey | YXVAVUOFVUEDJS-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.09 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|